C25H50N6O6 — CID 145076643
1-[2-[2-[2-[2-[amino-[(Z)-2-amino-3-(2,5-dioxopyrrol-1-yl)prop-1-enyl]amino]ethoxy]ethoxy]ethoxy]ethyl]-3-pentylurea;ethane (PubChem CID 145076643) has the molecular formula C25H50N6O6 and a molecular weight of 530.71 g/mol. Its IUPAC name is 1-[2-[2-[2-[2-[amino-[(Z)-2-amino-3-(2,5-dioxopyrrol-1-yl)prop-1-enyl]amino]ethoxy]ethoxy]ethoxy]ethyl]-3-pentylurea;ethane.
| Compound Name | 1-[2-[2-[2-[2-[amino-[(Z)-2-amino-3-(2,5-dioxopyrrol-1-yl)prop-1-enyl]amino]ethoxy]ethoxy]ethoxy]ethyl]-3-pentylurea;ethane |
|---|---|
| PubChem CID | 145076643 |
| Molecular Formula | C25H50N6O6 |
| Molecular Weight | 530.71 g/mol |
| Exact Mass | 530.38 |
| IUPAC Name | 1-[2-[2-[2-[2-[amino-[(Z)-2-amino-3-(2,5-dioxopyrrol-1-yl)prop-1-enyl]amino]ethoxy]ethoxy]ethoxy]ethyl]-3-pentylurea;ethane |
| SMILES | CC.CC.CCCCCNC(=O)NCCOCCOCCOCCN(N)/C=C(\N)CN1C(=O)C=CC1=O |
| InChI | InChI=1S/C21H38N6O6.2C2H6/c1-2-3-4-7-24-21(30)25-8-10-31-12-14-33-15-13-32-11-9-26(23)16-18(22)17-27-19(28)5-6-20(27)29;2*1-2/h5-6,16H,2-4,7-15,17,22-23H2,1H3,(H2,24,25,30);2*1-2H3/b18-16-;; |
| InChIKey | PNTFEVAJHVVZJY-KZYDBBBVSA-N |
| XLogP | 1.48 |
| TPSA | 161.48 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.71 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|