C14H20F3N3O7 — CID 134608618
N-[2-[2-(2-aminoethoxy)ethoxy]ethyl]-2-(2,5-dioxopyrrol-1-yl)acetamide;2,2,2-trifluoroacetic acid (PubChem CID 134608618) has the molecular formula C14H20F3N3O7 and a molecular weight of 399.32 g/mol. Its IUPAC name is N-[2-[2-(2-aminoethoxy)ethoxy]ethyl]-2-(2,5-dioxopyrrol-1-yl)acetamide;2,2,2-trifluoroacetic acid.
| Compound Name | N-[2-[2-(2-aminoethoxy)ethoxy]ethyl]-2-(2,5-dioxopyrrol-1-yl)acetamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 134608618 |
| Molecular Formula | C14H20F3N3O7 |
| Molecular Weight | 399.32 g/mol |
| Exact Mass | 399.13 |
| IUPAC Name | N-[2-[2-(2-aminoethoxy)ethoxy]ethyl]-2-(2,5-dioxopyrrol-1-yl)acetamide;2,2,2-trifluoroacetic acid |
| SMILES | NCCOCCOCCNC(=O)CN1C(=O)C=CC1=O.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C12H19N3O5.C2HF3O2/c13-3-5-19-7-8-20-6-4-14-10(16)9-15-11(17)1-2-12(15)18;3-2(4,5)1(6)7/h1-2H,3-9,13H2,(H,14,16);(H,6,7) |
| InChIKey | RHDUUNLAJRCUCW-UHFFFAOYSA-N |
| XLogP | -1.35 |
| TPSA | 148.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.32 |
| LogP ≤ 5 | -1.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|