C20H31F3N4O10 — CID 154725295
3-(2,5-dioxopyrrol-1-yl)-N-[2-[2-[2-[2-(3-hydrazinyl-3-oxopropoxy)ethoxy]ethoxy]ethoxy]ethyl]propanamide;2,2,2-trifluoroacetic acid (PubChem CID 154725295) has the molecular formula C20H31F3N4O10 and a molecular weight of 544.48 g/mol. Its IUPAC name is 3-(2,5-dioxopyrrol-1-yl)-N-[2-[2-[2-[2-(3-hydrazinyl-3-oxopropoxy)ethoxy]ethoxy]ethoxy]ethyl]propanamide;2,2,2-trifluoroacetic acid.
| Compound Name | 3-(2,5-dioxopyrrol-1-yl)-N-[2-[2-[2-[2-(3-hydrazinyl-3-oxopropoxy)ethoxy]ethoxy]ethoxy]ethyl]propanamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 154725295 |
| Molecular Formula | C20H31F3N4O10 |
| Molecular Weight | 544.48 g/mol |
| Exact Mass | 544.20 |
| IUPAC Name | 3-(2,5-dioxopyrrol-1-yl)-N-[2-[2-[2-[2-(3-hydrazinyl-3-oxopropoxy)ethoxy]ethoxy]ethoxy]ethyl]propanamide;2,2,2-trifluoroacetic acid |
| SMILES | NNC(=O)CCOCCOCCOCCOCCNC(=O)CCN1C(=O)C=CC1=O.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C18H30N4O8.C2HF3O2/c19-21-16(24)4-7-27-9-11-29-13-14-30-12-10-28-8-5-20-15(23)3-6-22-17(25)1-2-18(22)26;3-2(4,5)1(6)7/h1-2H,3-14,19H2,(H,20,23)(H,21,24);(H,6,7) |
| InChIKey | ALBUHSCPBLMTQT-UHFFFAOYSA-N |
| XLogP | -1.50 |
| TPSA | 195.82 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.48 |
| LogP ≤ 5 | -1.50 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|