C18H32N4O8 — CID 59828138
3-(2,5-dioxopyrrolidin-1-yl)-N-[2-[2-[2-[2-(3-hydrazinyl-3-oxopropoxy)ethoxy]ethoxy]ethoxy]ethyl]propanamide (PubChem CID 59828138) has the molecular formula C18H32N4O8 and a molecular weight of 432.47 g/mol. Its IUPAC name is 3-(2,5-dioxopyrrolidin-1-yl)-N-[2-[2-[2-[2-(3-hydrazinyl-3-oxopropoxy)ethoxy]ethoxy]ethoxy]ethyl]propanamide.
| Compound Name | 3-(2,5-dioxopyrrolidin-1-yl)-N-[2-[2-[2-[2-(3-hydrazinyl-3-oxopropoxy)ethoxy]ethoxy]ethoxy]ethyl]propanamide |
|---|---|
| PubChem CID | 59828138 |
| Molecular Formula | C18H32N4O8 |
| Molecular Weight | 432.47 g/mol |
| Exact Mass | 432.22 |
| IUPAC Name | 3-(2,5-dioxopyrrolidin-1-yl)-N-[2-[2-[2-[2-(3-hydrazinyl-3-oxopropoxy)ethoxy]ethoxy]ethoxy]ethyl]propanamide |
| SMILES | NNC(=O)CCOCCOCCOCCOCCNC(=O)CCN1C(=O)CCC1=O |
| InChI | InChI=1S/C18H32N4O8/c19-21-16(24)4-7-27-9-11-29-13-14-30-12-10-28-8-5-20-15(23)3-6-22-17(25)1-2-18(22)26/h1-14,19H2,(H,20,23)(H,21,24) |
| InChIKey | RPUXJQJNKDITFA-UHFFFAOYSA-N |
| XLogP | -1.91 |
| TPSA | 158.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.47 |
| LogP ≤ 5 | -1.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|