C32H51N3O13 — CID 158842922
6-(2,5-dioxopyrrolidin-1-yl)-N-[2-(2-ethoxyethoxy)ethyl]-5-oxohexanamide;2-(2-ethoxyethoxy)ethyl 6-(2,5-dioxopyrrolidin-1-yl)-5-oxohexanoate (PubChem CID 158842922) has the molecular formula C32H51N3O13 and a molecular weight of 685.77 g/mol. Its IUPAC name is 6-(2,5-dioxopyrrolidin-1-yl)-N-[2-(2-ethoxyethoxy)ethyl]-5-oxohexanamide;2-(2-ethoxyethoxy)ethyl 6-(2,5-dioxopyrrolidin-1-yl)-5-oxohexanoate.
| Compound Name | 6-(2,5-dioxopyrrolidin-1-yl)-N-[2-(2-ethoxyethoxy)ethyl]-5-oxohexanamide;2-(2-ethoxyethoxy)ethyl 6-(2,5-dioxopyrrolidin-1-yl)-5-oxohexanoate |
|---|---|
| PubChem CID | 158842922 |
| Molecular Formula | C32H51N3O13 |
| Molecular Weight | 685.77 g/mol |
| Exact Mass | 685.34 |
| IUPAC Name | 6-(2,5-dioxopyrrolidin-1-yl)-N-[2-(2-ethoxyethoxy)ethyl]-5-oxohexanamide;2-(2-ethoxyethoxy)ethyl 6-(2,5-dioxopyrrolidin-1-yl)-5-oxohexanoate |
| SMILES | CCOCCOCCNC(=O)CCCC(=O)CN1C(=O)CCC1=O.CCOCCOCCOC(=O)CCCC(=O)CN1C(=O)CCC1=O |
| InChI | InChI=1S/C16H26N2O6.C16H25NO7/c1-2-23-10-11-24-9-8-17-14(20)5-3-4-13(19)12-18-15(21)6-7-16(18)22;1-2-22-8-9-23-10-11-24-16(21)5-3-4-13(18)12-17-14(19)6-7-15(17)20/h2-12H2,1H3,(H,17,20);2-12H2,1H3 |
| InChIKey | IYLXCOYZEICWLO-UHFFFAOYSA-N |
| XLogP | 0.52 |
| TPSA | 201.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 685.77 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|