C19H30N2O9S — CID 145418066
4-[2-[2-[2-[2-[[2-(2,5-dioxopyrrol-1-yl)acetyl]amino]ethoxy]ethoxy]ethoxy]ethoxy]-2-(sulfanylmethyl)butanoic acid (PubChem CID 145418066) has the molecular formula C19H30N2O9S and a molecular weight of 462.52 g/mol. Its IUPAC name is 4-[2-[2-[2-[2-[[2-(2,5-dioxopyrrol-1-yl)acetyl]amino]ethoxy]ethoxy]ethoxy]ethoxy]-2-(sulfanylmethyl)butanoic acid.
| Compound Name | 4-[2-[2-[2-[2-[[2-(2,5-dioxopyrrol-1-yl)acetyl]amino]ethoxy]ethoxy]ethoxy]ethoxy]-2-(sulfanylmethyl)butanoic acid |
|---|---|
| PubChem CID | 145418066 |
| Molecular Formula | C19H30N2O9S |
| Molecular Weight | 462.52 g/mol |
| Exact Mass | 462.17 |
| IUPAC Name | 4-[2-[2-[2-[2-[[2-(2,5-dioxopyrrol-1-yl)acetyl]amino]ethoxy]ethoxy]ethoxy]ethoxy]-2-(sulfanylmethyl)butanoic acid |
| SMILES | O=C(CN1C(=O)C=CC1=O)NCCOCCOCCOCCOCCC(CS)C(=O)O |
| InChI | InChI=1S/C19H30N2O9S/c22-16(13-21-17(23)1-2-18(21)24)20-4-6-28-8-10-30-12-11-29-9-7-27-5-3-15(14-31)19(25)26/h1-2,15,31H,3-14H2,(H,20,22)(H,25,26) |
| InChIKey | ZXVHZSPBJZIIQV-UHFFFAOYSA-N |
| XLogP | -0.89 |
| TPSA | 140.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.52 |
| LogP ≤ 5 | -0.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|