C13H21N3O5 — CID 163909802
N-[2-[2-(2-aminoethoxy)ethoxy]ethyl]-2-(3,6-dioxo-2H-pyridin-1-yl)acetamide (PubChem CID 163909802) has the molecular formula C13H21N3O5 and a molecular weight of 299.33 g/mol. Its IUPAC name is N-[2-[2-(2-aminoethoxy)ethoxy]ethyl]-2-(3,6-dioxo-2H-pyridin-1-yl)acetamide.
| Compound Name | N-[2-[2-(2-aminoethoxy)ethoxy]ethyl]-2-(3,6-dioxo-2H-pyridin-1-yl)acetamide |
|---|---|
| PubChem CID | 163909802 |
| Molecular Formula | C13H21N3O5 |
| Molecular Weight | 299.33 g/mol |
| Exact Mass | 299.15 |
| IUPAC Name | N-[2-[2-(2-aminoethoxy)ethoxy]ethyl]-2-(3,6-dioxo-2H-pyridin-1-yl)acetamide |
| SMILES | NCCOCCOCCNC(=O)CN1CC(=O)C=CC1=O |
| InChI | InChI=1S/C13H21N3O5/c14-3-5-20-7-8-21-6-4-15-12(18)10-16-9-11(17)1-2-13(16)19/h1-2H,3-10,14H2,(H,15,18) |
| InChIKey | QRCGPPWDYCCXIT-UHFFFAOYSA-N |
| XLogP | -1.94 |
| TPSA | 110.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.33 |
| LogP ≤ 5 | -1.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|