C20H29N3O11 — CID 155040018
2-[3-[2-[2-[2-[[2-(2,5-dioxopyrrol-1-yl)acetyl]amino]ethoxy]ethoxy]ethoxy]propanoylamino]pentanedioic acid (PubChem CID 155040018) has the molecular formula C20H29N3O11 and a molecular weight of 487.46 g/mol. Its IUPAC name is 2-[3-[2-[2-[2-[[2-(2,5-dioxopyrrol-1-yl)acetyl]amino]ethoxy]ethoxy]ethoxy]propanoylamino]pentanedioic acid.
| Compound Name | 2-[3-[2-[2-[2-[[2-(2,5-dioxopyrrol-1-yl)acetyl]amino]ethoxy]ethoxy]ethoxy]propanoylamino]pentanedioic acid |
|---|---|
| PubChem CID | 155040018 |
| Molecular Formula | C20H29N3O11 |
| Molecular Weight | 487.46 g/mol |
| Exact Mass | 487.18 |
| IUPAC Name | 2-[3-[2-[2-[2-[[2-(2,5-dioxopyrrol-1-yl)acetyl]amino]ethoxy]ethoxy]ethoxy]propanoylamino]pentanedioic acid |
| SMILES | O=C(O)CCC(NC(=O)CCOCCOCCOCCNC(=O)CN1C(=O)C=CC1=O)C(=O)O |
| InChI | InChI=1S/C20H29N3O11/c24-15(22-14(20(30)31)1-4-19(28)29)5-7-32-9-11-34-12-10-33-8-6-21-16(25)13-23-17(26)2-3-18(23)27/h2-3,14H,1,4-13H2,(H,21,25)(H,22,24)(H,28,29)(H,30,31) |
| InChIKey | RSTLUKPRDPGMFS-UHFFFAOYSA-N |
| XLogP | -2.10 |
| TPSA | 197.87 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.46 |
| LogP ≤ 5 | -2.10 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|