C8H14BrF3N2O4 — CID 154803622
N-[2-(2-aminoethoxy)ethyl]-2-bromoacetamide;2,2,2-trifluoroacetic acid (PubChem CID 154803622) has the molecular formula C8H14BrF3N2O4 and a molecular weight of 339.11 g/mol. Its IUPAC name is N-[2-(2-aminoethoxy)ethyl]-2-bromoacetamide;2,2,2-trifluoroacetic acid.
| Compound Name | N-[2-(2-aminoethoxy)ethyl]-2-bromoacetamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 154803622 |
| Molecular Formula | C8H14BrF3N2O4 |
| Molecular Weight | 339.11 g/mol |
| Exact Mass | 338.01 |
| IUPAC Name | N-[2-(2-aminoethoxy)ethyl]-2-bromoacetamide;2,2,2-trifluoroacetic acid |
| SMILES | NCCOCCNC(=O)CBr.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C6H13BrN2O2.C2HF3O2/c7-5-6(10)9-2-4-11-3-1-8;3-2(4,5)1(6)7/h1-5,8H2,(H,9,10);(H,6,7) |
| InChIKey | ZWVNTOPILQPOER-UHFFFAOYSA-N |
| XLogP | 0.11 |
| TPSA | 101.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.11 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|