C9H17ClF3N3O3 — CID 156792788
N-[2-(2-aminoethoxy)ethyl]-3-[(2,2,2-trifluoroacetyl)amino]propanamide;hydrochloride (PubChem CID 156792788) has the molecular formula C9H17ClF3N3O3 and a molecular weight of 307.70 g/mol. Its IUPAC name is N-[2-(2-aminoethoxy)ethyl]-3-[(2,2,2-trifluoroacetyl)amino]propanamide;hydrochloride.
| Compound Name | N-[2-(2-aminoethoxy)ethyl]-3-[(2,2,2-trifluoroacetyl)amino]propanamide;hydrochloride |
|---|---|
| PubChem CID | 156792788 |
| Molecular Formula | C9H17ClF3N3O3 |
| Molecular Weight | 307.70 g/mol |
| Exact Mass | 307.09 |
| IUPAC Name | N-[2-(2-aminoethoxy)ethyl]-3-[(2,2,2-trifluoroacetyl)amino]propanamide;hydrochloride |
| SMILES | Cl.NCCOCCNC(=O)CCNC(=O)C(F)(F)F |
| InChI | InChI=1S/C9H16F3N3O3.ClH/c10-9(11,12)8(17)15-3-1-7(16)14-4-6-18-5-2-13;/h1-6,13H2,(H,14,16)(H,15,17);1H |
| InChIKey | MEPMPXJEPJNZRS-UHFFFAOYSA-N |
| XLogP | -0.43 |
| TPSA | 93.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.70 |
| LogP ≤ 5 | -0.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|