C9H19ClF3N3O3 — CID 156501444
N-[2-(2-aminoethoxy)ethyl]propanamide;2,2,2-trifluoroacetamide;hydrochloride (PubChem CID 156501444) has the molecular formula C9H19ClF3N3O3 and a molecular weight of 309.72 g/mol. Its IUPAC name is N-[2-(2-aminoethoxy)ethyl]propanamide;2,2,2-trifluoroacetamide;hydrochloride.
| Compound Name | N-[2-(2-aminoethoxy)ethyl]propanamide;2,2,2-trifluoroacetamide;hydrochloride |
|---|---|
| PubChem CID | 156501444 |
| Molecular Formula | C9H19ClF3N3O3 |
| Molecular Weight | 309.72 g/mol |
| Exact Mass | 309.11 |
| IUPAC Name | N-[2-(2-aminoethoxy)ethyl]propanamide;2,2,2-trifluoroacetamide;hydrochloride |
| SMILES | CCC(=O)NCCOCCN.Cl.NC(=O)C(F)(F)F |
| InChI | InChI=1S/C7H16N2O2.C2H2F3NO.ClH/c1-2-7(10)9-4-6-11-5-3-8;3-2(4,5)1(6)7;/h2-6,8H2,1H3,(H,9,10);(H2,6,7);1H |
| InChIKey | NKGLDUCAKJNVIT-UHFFFAOYSA-N |
| XLogP | -0.06 |
| TPSA | 107.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.72 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|