C15H29N3O2 — CID 129205053
tert-butyl N-[3-[[(2E,4Z)-5-aminohexa-2,4-dien-2-yl]-methylamino]propyl]carbamate (PubChem CID 129205053) has the molecular formula C15H29N3O2 and a molecular weight of 283.42 g/mol. Its IUPAC name is tert-butyl N-[3-[[(2E,4Z)-5-aminohexa-2,4-dien-2-yl]-methylamino]propyl]carbamate.
| Compound Name | tert-butyl N-[3-[[(2E,4Z)-5-aminohexa-2,4-dien-2-yl]-methylamino]propyl]carbamate |
|---|---|
| PubChem CID | 129205053 |
| Molecular Formula | C15H29N3O2 |
| Molecular Weight | 283.42 g/mol |
| Exact Mass | 283.23 |
| IUPAC Name | tert-butyl N-[3-[[(2E,4Z)-5-aminohexa-2,4-dien-2-yl]-methylamino]propyl]carbamate |
| SMILES | C/C(N)=C/C=C(\C)N(C)CCCNC(=O)OC(C)(C)C |
| InChI | InChI=1S/C15H29N3O2/c1-12(16)8-9-13(2)18(6)11-7-10-17-14(19)20-15(3,4)5/h8-9H,7,10-11,16H2,1-6H3,(H,17,19)/b12-8-,13-9+ |
| InChIKey | OSZQAUVLHJWJNC-QRBCZBMESA-N |
| XLogP | 2.60 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.42 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|