C10H22N4O2S — CID 129112999
tert-butyl N-[4-[amino(carbamothioyl)amino]butyl]carbamate (PubChem CID 129112999) has the molecular formula C10H22N4O2S and a molecular weight of 262.38 g/mol. Its IUPAC name is tert-butyl N-[4-[amino(carbamothioyl)amino]butyl]carbamate.
| Compound Name | tert-butyl N-[4-[amino(carbamothioyl)amino]butyl]carbamate |
|---|---|
| PubChem CID | 129112999 |
| Molecular Formula | C10H22N4O2S |
| Molecular Weight | 262.38 g/mol |
| Exact Mass | 262.15 |
| IUPAC Name | tert-butyl N-[4-[amino(carbamothioyl)amino]butyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCCCN(N)C(N)=S |
| InChI | InChI=1S/C10H22N4O2S/c1-10(2,3)16-9(15)13-6-4-5-7-14(12)8(11)17/h4-7,12H2,1-3H3,(H2,11,17)(H,13,15) |
| InChIKey | ZYXCMSPRKSGDJN-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 93.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.38 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|