C10H23N3O4S — CID 174632214
1-[(2-methylpropan-2-yl)oxycarbonylamino]-4-[methyl-(sulfinoamino)amino]butane (PubChem CID 174632214) has the molecular formula C10H23N3O4S and a molecular weight of 281.38 g/mol. Its IUPAC name is 1-[(2-methylpropan-2-yl)oxycarbonylamino]-4-[methyl-(sulfinoamino)amino]butane.
| Compound Name | 1-[(2-methylpropan-2-yl)oxycarbonylamino]-4-[methyl-(sulfinoamino)amino]butane |
|---|---|
| PubChem CID | 174632214 |
| Molecular Formula | C10H23N3O4S |
| Molecular Weight | 281.38 g/mol |
| Exact Mass | 281.14 |
| IUPAC Name | 1-[(2-methylpropan-2-yl)oxycarbonylamino]-4-[methyl-(sulfinoamino)amino]butane |
| SMILES | CN(CCCCNC(=O)OC(C)(C)C)NS(=O)O |
| InChI | InChI=1S/C10H23N3O4S/c1-10(2,3)17-9(14)11-7-5-6-8-13(4)12-18(15)16/h12H,5-8H2,1-4H3,(H,11,14)(H,15,16) |
| InChIKey | FKBLNILJRVRVLS-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 90.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.38 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|