C12H25BrN2 — CID 145385176
N'-[(2E,4E)-5-bromohexa-2,4-dien-2-yl]-N,N'-dimethylethane-1,2-diamine;ethane (PubChem CID 145385176) has the molecular formula C12H25BrN2 and a molecular weight of 277.25 g/mol. Its IUPAC name is N'-[(2E,4E)-5-bromohexa-2,4-dien-2-yl]-N,N'-dimethylethane-1,2-diamine;ethane.
| Compound Name | N'-[(2E,4E)-5-bromohexa-2,4-dien-2-yl]-N,N'-dimethylethane-1,2-diamine;ethane |
|---|---|
| PubChem CID | 145385176 |
| Molecular Formula | C12H25BrN2 |
| Molecular Weight | 277.25 g/mol |
| Exact Mass | 276.12 |
| IUPAC Name | N'-[(2E,4E)-5-bromohexa-2,4-dien-2-yl]-N,N'-dimethylethane-1,2-diamine;ethane |
| SMILES | CC.CNCCN(C)/C(C)=C/C=C(\C)Br |
| InChI | InChI=1S/C10H19BrN2.C2H6/c1-9(11)5-6-10(2)13(4)8-7-12-3;1-2/h5-6,12H,7-8H2,1-4H3;1-2H3/b9-5+,10-6+; |
| InChIKey | RXBAIIFOLCCDLD-QJQFWQJTSA-N |
| XLogP | 3.37 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.25 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|