C12H23FN2 — CID 143846291
ethane;N'-[(3Z)-5-fluorohexa-1,3,5-trien-2-yl]-N,N'-dimethylethane-1,2-diamine (PubChem CID 143846291) has the molecular formula C12H23FN2 and a molecular weight of 214.33 g/mol. Its IUPAC name is ethane;N'-[(3Z)-5-fluorohexa-1,3,5-trien-2-yl]-N,N'-dimethylethane-1,2-diamine.
| Compound Name | ethane;N'-[(3Z)-5-fluorohexa-1,3,5-trien-2-yl]-N,N'-dimethylethane-1,2-diamine |
|---|---|
| PubChem CID | 143846291 |
| Molecular Formula | C12H23FN2 |
| Molecular Weight | 214.33 g/mol |
| Exact Mass | 214.18 |
| IUPAC Name | ethane;N'-[(3Z)-5-fluorohexa-1,3,5-trien-2-yl]-N,N'-dimethylethane-1,2-diamine |
| SMILES | C=C(F)/C=C\C(=C)N(C)CCNC.CC |
| InChI | InChI=1S/C10H17FN2.C2H6/c1-9(11)5-6-10(2)13(4)8-7-12-3;1-2/h5-6,12H,1-2,7-8H2,3-4H3;1-2H3/b6-5-; |
| InChIKey | XOLQNGSXVAHWAH-YSMBQZINSA-N |
| XLogP | 2.72 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.33 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|