C11H18N2O — CID 123169472
2-methylidene-5-[methyl-[2-(methylamino)ethyl]amino]hexa-3,5-dienal (PubChem CID 123169472) has the molecular formula C11H18N2O and a molecular weight of 194.28 g/mol. Its IUPAC name is 2-methylidene-5-[methyl-[2-(methylamino)ethyl]amino]hexa-3,5-dienal.
| Compound Name | 2-methylidene-5-[methyl-[2-(methylamino)ethyl]amino]hexa-3,5-dienal |
|---|---|
| PubChem CID | 123169472 |
| Molecular Formula | C11H18N2O |
| Molecular Weight | 194.28 g/mol |
| Exact Mass | 194.14 |
| IUPAC Name | 2-methylidene-5-[methyl-[2-(methylamino)ethyl]amino]hexa-3,5-dienal |
| SMILES | C=C(C=O)C=CC(=C)N(C)CCNC |
| InChI | InChI=1S/C11H18N2O/c1-10(9-14)5-6-11(2)13(4)8-7-12-3/h5-6,9,12H,1-2,7-8H2,3-4H3 |
| InChIKey | YZCWBHPSHLVGKO-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.28 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|