About 2-methylidene-5-[methyl-[2-(methylamino)ethyl]amino]hexa-3,5-dienal
2-methylidene-5-[methyl-[2-(methylamino)ethyl]amino]hexa-3,5-dienal (PubChem CID 123169472) has the molecular formula C11H18N2O
and a molecular weight of 194.28 g/mol. Its IUPAC name is 2-methylidene-5-[methyl-[2-(methylamino)ethyl]amino]hexa-3,5-dienal.
Molecular Properties
| Compound Name | 2-methylidene-5-[methyl-[2-(methylamino)ethyl]amino]hexa-3,5-dienal |
| PubChem CID | 123169472 |
| Molecular Formula | C11H18N2O |
| Molecular Weight | 194.28 g/mol |
| Exact Mass | 194.14 |
| IUPAC Name | 2-methylidene-5-[methyl-[2-(methylamino)ethyl]amino]hexa-3,5-dienal |
| SMILES | C=C(C=O)C=CC(=C)N(C)CCNC |
| InChI | InChI=1S/C11H18N2O/c1-10(9-14)5-6-11(2)13(4)8-7-12-3/h5-6,9,12H,1-2,7-8H2,3-4H3 |
| InChIKey | YZCWBHPSHLVGKO-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.28 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 2-methylidene-5-[methyl-[2-(methylamino)ethyl]amino]hexa-3,5-dienal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylidene-5-[methyl-[2-(methylamino)ethyl]amino]hexa-3,5-dienal?
The IUPAC name of 2-methylidene-5-[methyl-[2-(methylamino)ethyl]amino]hexa-3,5-dienal (CID 123169472) is 2-methylidene-5-[methyl-[2-(methylamino)ethyl]amino]hexa-3,5-dienal.
What is the SMILES notation for 2-methylidene-5-[methyl-[2-(methylamino)ethyl]amino]hexa-3,5-dienal?
The canonical SMILES for 2-methylidene-5-[methyl-[2-(methylamino)ethyl]amino]hexa-3,5-dienal is C=C(C=O)C=CC(=C)N(C)CCNC.
What is the InChIKey of 2-methylidene-5-[methyl-[2-(methylamino)ethyl]amino]hexa-3,5-dienal?
The InChIKey is YZCWBHPSHLVGKO-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H18N2O/c1-10(9-14)5-6-11(2)13(4)8-7-12-3/h5-6,9,12H,1-2,7-8H2,3-4H3.
What are the key properties of 2-methylidene-5-[methyl-[2-(methylamino)ethyl]amino]hexa-3,5-dienal?
2-methylidene-5-[methyl-[2-(methylamino)ethyl]amino]hexa-3,5-dienal has a molecular weight of 194.28 g/mol, XLogP of 0.96, 7 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylidene-5-[methyl-[2-(methylamino)ethyl]amino]hexa-3,5-dienal is sourced from PubChem (CID 123169472), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).