C16H29F3N2O — CID 158997171
N-methylhex-5-en-1-amine;2,2,2-trifluoro-N-hex-5-enyl-N-methylacetamide (PubChem CID 158997171) has the molecular formula C16H29F3N2O and a molecular weight of 322.42 g/mol. Its IUPAC name is N-methylhex-5-en-1-amine;2,2,2-trifluoro-N-hex-5-enyl-N-methylacetamide.
| Compound Name | N-methylhex-5-en-1-amine;2,2,2-trifluoro-N-hex-5-enyl-N-methylacetamide |
|---|---|
| PubChem CID | 158997171 |
| Molecular Formula | C16H29F3N2O |
| Molecular Weight | 322.42 g/mol |
| Exact Mass | 322.22 |
| IUPAC Name | N-methylhex-5-en-1-amine;2,2,2-trifluoro-N-hex-5-enyl-N-methylacetamide |
| SMILES | C=CCCCCN(C)C(=O)C(F)(F)F.C=CCCCCNC |
| InChI | InChI=1S/C9H14F3NO.C7H15N/c1-3-4-5-6-7-13(2)8(14)9(10,11)12;1-3-4-5-6-7-8-2/h3H,1,4-7H2,2H3;3,8H,1,4-7H2,2H3 |
| InChIKey | JQWMOFCWCPUGQH-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.42 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|