C9H12F3N3O2 — CID 85349244
N-(6-diazo-5-oxohexyl)-2,2,2-trifluoro-N-methylacetamide (PubChem CID 85349244) has the molecular formula C9H12F3N3O2 and a molecular weight of 251.21 g/mol. Its IUPAC name is N-(6-diazo-5-oxohexyl)-2,2,2-trifluoro-N-methylacetamide.
| Compound Name | N-(6-diazo-5-oxohexyl)-2,2,2-trifluoro-N-methylacetamide |
|---|---|
| PubChem CID | 85349244 |
| Molecular Formula | C9H12F3N3O2 |
| Molecular Weight | 251.21 g/mol |
| Exact Mass | 251.09 |
| IUPAC Name | N-(6-diazo-5-oxohexyl)-2,2,2-trifluoro-N-methylacetamide |
| SMILES | CN(CCCCC(=O)C=[N+]=[N-])C(=O)C(F)(F)F |
| InChI | InChI=1S/C9H12F3N3O2/c1-15(8(17)9(10,11)12)5-3-2-4-7(16)6-14-13/h6H,2-5H2,1H3 |
| InChIKey | GCOIVZGIPJWGKT-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 73.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.21 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|