C24H36F3NO2S — CID 14564846
2,2,2-trifluoro-N-methyl-N-[(E)-6-[2,4,6-tri(propan-2-yl)phenyl]sulfinylhex-5-enyl]acetamide (PubChem CID 14564846) has the molecular formula C24H36F3NO2S and a molecular weight of 459.62 g/mol. Its IUPAC name is 2,2,2-trifluoro-N-methyl-N-[(E)-6-[2,4,6-tri(propan-2-yl)phenyl]sulfinylhex-5-enyl]acetamide.
| Compound Name | 2,2,2-trifluoro-N-methyl-N-[(E)-6-[2,4,6-tri(propan-2-yl)phenyl]sulfinylhex-5-enyl]acetamide |
|---|---|
| PubChem CID | 14564846 |
| Molecular Formula | C24H36F3NO2S |
| Molecular Weight | 459.62 g/mol |
| Exact Mass | 459.24 |
| IUPAC Name | 2,2,2-trifluoro-N-methyl-N-[(E)-6-[2,4,6-tri(propan-2-yl)phenyl]sulfinylhex-5-enyl]acetamide |
| SMILES | CC(C)c1cc(C(C)C)c(S(=O)/C=C/CCCCN(C)C(=O)C(F)(F)F)c(C(C)C)c1 |
| InChI | InChI=1S/C24H36F3NO2S/c1-16(2)19-14-20(17(3)4)22(21(15-19)18(5)6)31(30)13-11-9-8-10-12-28(7)23(29)24(25,26)27/h11,13-18H,8-10,12H2,1-7H3/b13-11+ |
| InChIKey | RPNQEIDBWAPIDU-ACCUITESSA-N |
| XLogP | 6.87 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.62 |
| LogP ≤ 5 | 6.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|