C20H37N3O — CID 118900904
1,3-bis(hex-5-enyl)-1-[hex-5-enyl(methyl)amino]urea (PubChem CID 118900904) has the molecular formula C20H37N3O and a molecular weight of 335.54 g/mol. Its IUPAC name is 1,3-bis(hex-5-enyl)-1-[hex-5-enyl(methyl)amino]urea.
| Compound Name | 1,3-bis(hex-5-enyl)-1-[hex-5-enyl(methyl)amino]urea |
|---|---|
| PubChem CID | 118900904 |
| Molecular Formula | C20H37N3O |
| Molecular Weight | 335.54 g/mol |
| Exact Mass | 335.29 |
| IUPAC Name | 1,3-bis(hex-5-enyl)-1-[hex-5-enyl(methyl)amino]urea |
| SMILES | C=CCCCCNC(=O)N(CCCCC=C)N(C)CCCCC=C |
| InChI | InChI=1S/C20H37N3O/c1-5-8-11-14-17-21-20(24)23(19-16-13-10-7-3)22(4)18-15-12-9-6-2/h5-7H,1-3,8-19H2,4H3,(H,21,24) |
| InChIKey | KYNQILCUSHKXBJ-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.54 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|