C14H28N2OS — CID 88765921
1,3-dipentyl-1-prop-2-enylsulfanylurea (PubChem CID 88765921) has the molecular formula C14H28N2OS and a molecular weight of 272.46 g/mol. Its IUPAC name is 1,3-dipentyl-1-prop-2-enylsulfanylurea.
| Compound Name | 1,3-dipentyl-1-prop-2-enylsulfanylurea |
|---|---|
| PubChem CID | 88765921 |
| Molecular Formula | C14H28N2OS |
| Molecular Weight | 272.46 g/mol |
| Exact Mass | 272.19 |
| IUPAC Name | 1,3-dipentyl-1-prop-2-enylsulfanylurea |
| SMILES | C=CCSN(CCCCC)C(=O)NCCCCC |
| InChI | InChI=1S/C14H28N2OS/c1-4-7-9-11-15-14(17)16(18-13-6-3)12-10-8-5-2/h6H,3-5,7-13H2,1-2H3,(H,15,17) |
| InChIKey | RKLHQVZMDJCVOM-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.46 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|