C9H15NO — CID 122404178
(E)-N-pent-4-enylbut-2-enamide (PubChem CID 122404178) has the molecular formula C9H15NO and a molecular weight of 153.22 g/mol. Its IUPAC name is (E)-N-pent-4-enylbut-2-enamide.
| Compound Name | (E)-N-pent-4-enylbut-2-enamide |
|---|---|
| PubChem CID | 122404178 |
| Molecular Formula | C9H15NO |
| Molecular Weight | 153.22 g/mol |
| Exact Mass | 153.12 |
| IUPAC Name | (E)-N-pent-4-enylbut-2-enamide |
| SMILES | C=CCCCNC(=O)/C=C/C |
| InChI | InChI=1S/C9H15NO/c1-3-5-6-8-10-9(11)7-4-2/h3-4,7H,1,5-6,8H2,2H3,(H,10,11)/b7-4+ |
| InChIKey | PQRTVQHUHRPGOP-QPJJXVBHSA-N |
| XLogP | 1.64 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 153.22 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|