C7H12KNO4S — CID 141499458
potassium 3-(but-2-enoylamino)propane-1-sulfonate (PubChem CID 141499458) has the molecular formula C7H12KNO4S and a molecular weight of 245.34 g/mol. Its IUPAC name is potassium 3-(but-2-enoylamino)propane-1-sulfonate.
| Compound Name | potassium 3-(but-2-enoylamino)propane-1-sulfonate |
|---|---|
| PubChem CID | 141499458 |
| Molecular Formula | C7H12KNO4S |
| Molecular Weight | 245.34 g/mol |
| Exact Mass | 245.01 |
| IUPAC Name | potassium 3-(but-2-enoylamino)propane-1-sulfonate |
| SMILES | CC=CC(=O)NCCCS(=O)(=O)[O-].[K+] |
| InChI | InChI=1S/C7H13NO4S.K/c1-2-4-7(9)8-5-3-6-13(10,11)12;/h2,4H,3,5-6H2,1H3,(H,8,9)(H,10,11,12);/q;+1/p-1 |
| InChIKey | VYTDOTKRYHIMGS-UHFFFAOYSA-M |
| XLogP | -3.38 |
| TPSA | 86.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.34 |
| LogP ≤ 5 | -3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|