C8H16CaNO4S+ — CID 21180951
calcium 3-(3-methylbutanoylamino)propane-1-sulfonate (PubChem CID 21180951) has the molecular formula C8H16CaNO4S+ and a molecular weight of 262.36 g/mol. Its IUPAC name is calcium 3-(3-methylbutanoylamino)propane-1-sulfonate.
| Compound Name | calcium 3-(3-methylbutanoylamino)propane-1-sulfonate |
|---|---|
| PubChem CID | 21180951 |
| Molecular Formula | C8H16CaNO4S+ |
| Molecular Weight | 262.36 g/mol |
| Exact Mass | 262.04 |
| IUPAC Name | calcium 3-(3-methylbutanoylamino)propane-1-sulfonate |
| SMILES | CC(C)CC(=O)NCCCS(=O)(=O)[O-].[Ca+2] |
| InChI | InChI=1S/C8H17NO4S.Ca/c1-7(2)6-8(10)9-4-3-5-14(11,12)13;/h7H,3-6H2,1-2H3,(H,9,10)(H,11,12,13);/q;+2/p-1 |
| InChIKey | CJONRUDWVLURNE-UHFFFAOYSA-M |
| XLogP | -0.30 |
| TPSA | 86.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.36 |
| LogP ≤ 5 | -0.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|