C27H40N2 — CID 167028364
N'-[(2E,4E,6Z,8E,10Z)-7-ethyl-5-methyl-6-[(1E,3Z)-4-methylhexa-1,3,5-trienyl]trideca-2,4,6,8,10,12-hexaen-2-yl]-N,N'-dimethylethane-1,2-diamine (PubChem CID 167028364) has the molecular formula C27H40N2 and a molecular weight of 392.63 g/mol. Its IUPAC name is N'-[(2E,4E,6Z,8E,10Z)-7-ethyl-5-methyl-6-[(1E,3Z)-4-methylhexa-1,3,5-trienyl]trideca-2,4,6,8,10,12-hexaen-2-yl]-N,N'-dimethylethane-1,2-diamine.
| Compound Name | N'-[(2E,4E,6Z,8E,10Z)-7-ethyl-5-methyl-6-[(1E,3Z)-4-methylhexa-1,3,5-trienyl]trideca-2,4,6,8,10,12-hexaen-2-yl]-N,N'-dimethylethane-1,2-diamine |
|---|---|
| PubChem CID | 167028364 |
| Molecular Formula | C27H40N2 |
| Molecular Weight | 392.63 g/mol |
| Exact Mass | 392.32 |
| IUPAC Name | N'-[(2E,4E,6Z,8E,10Z)-7-ethyl-5-methyl-6-[(1E,3Z)-4-methylhexa-1,3,5-trienyl]trideca-2,4,6,8,10,12-hexaen-2-yl]-N,N'-dimethylethane-1,2-diamine |
| SMILES | C=C/C=C\C=C\C(CC)=C(\C=C/C=C(/C)C=C)C(/C)=C/C=C(\C)N(C)CCNC |
| InChI | InChI=1S/C27H40N2/c1-9-12-13-14-17-26(11-3)27(18-15-16-23(4)10-2)24(5)19-20-25(6)29(8)22-21-28-7/h9-10,12-20,28H,1-2,11,21-22H2,3-8H3/b13-12-,17-14+,18-15+,23-16-,24-19+,25-20+,27-26- |
| InChIKey | BJEAASHQCQHIAO-HRGPDYAZSA-N |
| XLogP | 6.68 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.63 |
| LogP ≤ 5 | 6.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|