C14H19N — CID 20710682
(1E,3E,5E,7E,9E)-N,10-dimethyldodeca-1,3,5,7,9,11-hexaen-1-amine (PubChem CID 20710682) has the molecular formula C14H19N and a molecular weight of 201.31 g/mol. Its IUPAC name is (1E,3E,5E,7E,9E)-N,10-dimethyldodeca-1,3,5,7,9,11-hexaen-1-amine.
| Compound Name | (1E,3E,5E,7E,9E)-N,10-dimethyldodeca-1,3,5,7,9,11-hexaen-1-amine |
|---|---|
| PubChem CID | 20710682 |
| Molecular Formula | C14H19N |
| Molecular Weight | 201.31 g/mol |
| Exact Mass | 201.15 |
| IUPAC Name | (1E,3E,5E,7E,9E)-N,10-dimethyldodeca-1,3,5,7,9,11-hexaen-1-amine |
| SMILES | C=C/C(C)=C/C=C/C=C/C=C/C=C/NC |
| InChI | InChI=1S/C14H19N/c1-4-14(2)12-10-8-6-5-7-9-11-13-15-3/h4-13,15H,1H2,2-3H3/b6-5+,9-7+,10-8+,13-11+,14-12+ |
| InChIKey | XOTWKQWAAMPYRL-IKBQUROISA-N |
| XLogP | 3.52 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.31 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|