C7H9Cl — CID 87415346
(1E,3Z)-1-chloro-4-methylhexa-1,3,5-triene (PubChem CID 87415346) has the molecular formula C7H9Cl and a molecular weight of 128.60 g/mol. Its IUPAC name is (1E,3Z)-1-chloro-4-methylhexa-1,3,5-triene.
| Compound Name | (1E,3Z)-1-chloro-4-methylhexa-1,3,5-triene |
|---|---|
| PubChem CID | 87415346 |
| Molecular Formula | C7H9Cl |
| Molecular Weight | 128.60 g/mol |
| Exact Mass | 128.04 |
| IUPAC Name | (1E,3Z)-1-chloro-4-methylhexa-1,3,5-triene |
| SMILES | C=C/C(C)=C\C=C\Cl |
| InChI | InChI=1S/C7H9Cl/c1-3-7(2)5-4-6-8/h3-6H,1H2,2H3/b6-4+,7-5- |
| InChIKey | OURPLIXTRFXQBO-GUBXDBFYSA-N |
| XLogP | 2.87 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 128.60 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|