C10H16 — CID 144680511
(3Z,5Z)-3-methylnona-1,3,5-triene (PubChem CID 144680511) has the molecular formula C10H16 and a molecular weight of 136.24 g/mol. Its IUPAC name is (3Z,5Z)-3-methylnona-1,3,5-triene.
| Compound Name | (3Z,5Z)-3-methylnona-1,3,5-triene |
|---|---|
| PubChem CID | 144680511 |
| Molecular Formula | C10H16 |
| Molecular Weight | 136.24 g/mol |
| Exact Mass | 136.13 |
| IUPAC Name | (3Z,5Z)-3-methylnona-1,3,5-triene |
| SMILES | C=C/C(C)=C\C=C/CCC |
| InChI | InChI=1S/C10H16/c1-4-6-7-8-9-10(3)5-2/h5,7-9H,2,4,6H2,1,3H3/b8-7-,10-9- |
| InChIKey | HHFDHJOHXMOQMI-QRLRYFCNSA-N |
| XLogP | 3.47 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 136.24 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|