C14H22O — CID 102265677
(7E,9E)-3,10-dimethyldodeca-7,9,11-trien-4-one (PubChem CID 102265677) has the molecular formula C14H22O and a molecular weight of 206.33 g/mol. Its IUPAC name is (7E,9E)-3,10-dimethyldodeca-7,9,11-trien-4-one.
| Compound Name | (7E,9E)-3,10-dimethyldodeca-7,9,11-trien-4-one |
|---|---|
| PubChem CID | 102265677 |
| Molecular Formula | C14H22O |
| Molecular Weight | 206.33 g/mol |
| Exact Mass | 206.17 |
| IUPAC Name | (7E,9E)-3,10-dimethyldodeca-7,9,11-trien-4-one |
| SMILES | C=C/C(C)=C/C=C/CCC(=O)C(C)CC |
| InChI | InChI=1S/C14H22O/c1-5-12(3)10-8-7-9-11-14(15)13(4)6-2/h5,7-8,10,13H,1,6,9,11H2,2-4H3/b8-7+,12-10+ |
| InChIKey | IKBFXVHEJNMHIS-DCXZXJRMSA-N |
| XLogP | 4.07 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.33 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|