C15H22 — CID 162885437
(3E,5E,7R,8Z)-3,7,11-trimethyldodeca-1,3,5,8,10-pentaene (PubChem CID 162885437) has the molecular formula C15H22 and a molecular weight of 202.34 g/mol. Its IUPAC name is (3E,5E,7R,8Z)-3,7,11-trimethyldodeca-1,3,5,8,10-pentaene.
| Compound Name | (3E,5E,7R,8Z)-3,7,11-trimethyldodeca-1,3,5,8,10-pentaene |
|---|---|
| PubChem CID | 162885437 |
| Molecular Formula | C15H22 |
| Molecular Weight | 202.34 g/mol |
| Exact Mass | 202.17 |
| IUPAC Name | (3E,5E,7R,8Z)-3,7,11-trimethyldodeca-1,3,5,8,10-pentaene |
| SMILES | C=C/C(C)=C/C=C/[C@H](C)/C=C\C=C(C)C |
| InChI | InChI=1S/C15H22/c1-6-14(4)10-8-12-15(5)11-7-9-13(2)3/h6-12,15H,1H2,2-5H3/b11-7-,12-8+,14-10+/t15-/m1/s1 |
| InChIKey | DSZALOUXXLZEOV-JKCLIQRDSA-N |
| XLogP | 4.83 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.34 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|