C20H36 — CID 162272245
2,6-dimethylhepta-2,4-diene;2,7-dimethylocta-2,4,6-triene;methane (PubChem CID 162272245) has the molecular formula C20H36 and a molecular weight of 276.51 g/mol. Its IUPAC name is 2,6-dimethylhepta-2,4-diene;2,7-dimethylocta-2,4,6-triene;methane.
| Compound Name | 2,6-dimethylhepta-2,4-diene;2,7-dimethylocta-2,4,6-triene;methane |
|---|---|
| PubChem CID | 162272245 |
| Molecular Formula | C20H36 |
| Molecular Weight | 276.51 g/mol |
| Exact Mass | 276.28 |
| IUPAC Name | 2,6-dimethylhepta-2,4-diene;2,7-dimethylocta-2,4,6-triene;methane |
| SMILES | C.CC(C)=CC=CC(C)C.CC(C)=CC=CC=C(C)C |
| InChI | InChI=1S/C10H16.C9H16.CH4/c1-9(2)7-5-6-8-10(3)4;1-8(2)6-5-7-9(3)4;/h5-8H,1-4H3;5-8H,1-4H3;1H4 |
| InChIKey | HLKFFYMZKGTTTI-UHFFFAOYSA-N |
| XLogP | 7.28 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.51 |
| LogP ≤ 5 | 7.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|