C18H34 — CID 158024644
(E)-2,5-dimethylhex-3-ene;(3E,5E)-2,7-dimethylocta-3,5-diene (PubChem CID 158024644) has the molecular formula C18H34 and a molecular weight of 250.47 g/mol. Its IUPAC name is (E)-2,5-dimethylhex-3-ene;(3E,5E)-2,7-dimethylocta-3,5-diene.
| Compound Name | (E)-2,5-dimethylhex-3-ene;(3E,5E)-2,7-dimethylocta-3,5-diene |
|---|---|
| PubChem CID | 158024644 |
| Molecular Formula | C18H34 |
| Molecular Weight | 250.47 g/mol |
| Exact Mass | 250.27 |
| IUPAC Name | (E)-2,5-dimethylhex-3-ene;(3E,5E)-2,7-dimethylocta-3,5-diene |
| SMILES | CC(C)/C=C/C(C)C.CC(C)/C=C/C=C/C(C)C |
| InChI | InChI=1S/C10H18.C8H16/c1-9(2)7-5-6-8-10(3)4;1-7(2)5-6-8(3)4/h5-10H,1-4H3;5-8H,1-4H3/b7-5+,8-6+;6-5+ |
| InChIKey | FGLOSIBORVQUMN-FPVLBZLZSA-N |
| XLogP | 6.27 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.47 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|