About (1E,3E)-1-iodo-5-methylhexa-1,3-diene
(1E,3E)-1-iodo-5-methylhexa-1,3-diene (PubChem CID 88539318) has the molecular formula C7H11I
and a molecular weight of 222.07 g/mol. Its IUPAC name is (1E,3E)-1-iodo-5-methylhexa-1,3-diene.
Molecular Properties
| Compound Name | (1E,3E)-1-iodo-5-methylhexa-1,3-diene |
| PubChem CID | 88539318 |
| Molecular Formula | C7H11I |
| Molecular Weight | 222.07 g/mol |
| Exact Mass | 221.99 |
| IUPAC Name | (1E,3E)-1-iodo-5-methylhexa-1,3-diene |
| SMILES | CC(C)/C=C/C=C/I |
| InChI | InChI=1S/C7H11I/c1-7(2)5-3-4-6-8/h3-7H,1-2H3/b5-3+,6-4+ |
| InChIKey | KMBLRUSCLSMSDN-GGWOSOGESA-N |
| XLogP | 3.15 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.07 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (1E,3E)-1-iodo-5-methylhexa-1,3-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1E,3E)-1-iodo-5-methylhexa-1,3-diene?
The IUPAC name of (1E,3E)-1-iodo-5-methylhexa-1,3-diene (CID 88539318) is (1E,3E)-1-iodo-5-methylhexa-1,3-diene.
What is the SMILES notation for (1E,3E)-1-iodo-5-methylhexa-1,3-diene?
The canonical SMILES for (1E,3E)-1-iodo-5-methylhexa-1,3-diene is CC(C)/C=C/C=C/I.
What is the InChIKey of (1E,3E)-1-iodo-5-methylhexa-1,3-diene?
The InChIKey is KMBLRUSCLSMSDN-GGWOSOGESA-N. The full InChI is InChI=1S/C7H11I/c1-7(2)5-3-4-6-8/h3-7H,1-2H3/b5-3+,6-4+.
What are the key properties of (1E,3E)-1-iodo-5-methylhexa-1,3-diene?
(1E,3E)-1-iodo-5-methylhexa-1,3-diene has a molecular weight of 222.07 g/mol, XLogP of 3.15, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for (1E,3E)-1-iodo-5-methylhexa-1,3-diene is sourced from PubChem (CID 88539318), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).