C10H19N — CID 143010225
ethane;N-[(1Z,3Z)-5-methylhexa-1,3-dienyl]methanimine (PubChem CID 143010225) has the molecular formula C10H19N and a molecular weight of 153.27 g/mol. Its IUPAC name is ethane;N-[(1Z,3Z)-5-methylhexa-1,3-dienyl]methanimine.
| Compound Name | ethane;N-[(1Z,3Z)-5-methylhexa-1,3-dienyl]methanimine |
|---|---|
| PubChem CID | 143010225 |
| Molecular Formula | C10H19N |
| Molecular Weight | 153.27 g/mol |
| Exact Mass | 153.15 |
| IUPAC Name | ethane;N-[(1Z,3Z)-5-methylhexa-1,3-dienyl]methanimine |
| SMILES | C=N/C=C\C=C/C(C)C.CC |
| InChI | InChI=1S/C8H13N.C2H6/c1-8(2)6-4-5-7-9-3;1-2/h4-8H,3H2,1-2H3;1-2H3/b6-4-,7-5-; |
| InChIKey | HYHADSSAQPJILL-ISOJEIHBSA-N |
| XLogP | 3.44 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 153.27 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|