C15H27NO — CID 142914051
methanol;N-[(2E,4Z,6E)-8-methyl-3-propan-2-ylnona-2,4,6-trien-2-yl]methanimine (PubChem CID 142914051) has the molecular formula C15H27NO and a molecular weight of 237.39 g/mol. Its IUPAC name is methanol;N-[(2E,4Z,6E)-8-methyl-3-propan-2-ylnona-2,4,6-trien-2-yl]methanimine.
| Compound Name | methanol;N-[(2E,4Z,6E)-8-methyl-3-propan-2-ylnona-2,4,6-trien-2-yl]methanimine |
|---|---|
| PubChem CID | 142914051 |
| Molecular Formula | C15H27NO |
| Molecular Weight | 237.39 g/mol |
| Exact Mass | 237.21 |
| IUPAC Name | methanol;N-[(2E,4Z,6E)-8-methyl-3-propan-2-ylnona-2,4,6-trien-2-yl]methanimine |
| SMILES | C=N/C(C)=C(/C=C\C=C\C(C)C)C(C)C.CO |
| InChI | InChI=1S/C14H23N.CH4O/c1-11(2)9-7-8-10-14(12(3)4)13(5)15-6;1-2/h7-12H,6H2,1-5H3;2H,1H3/b9-7+,10-8-,14-13-; |
| InChIKey | YZXPRYIZUJKEBA-UYEYKSOQSA-N |
| XLogP | 3.99 |
| TPSA | 32.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.39 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|