C10H15IO — CID 137490290
[(2E,4Z)-3-propan-2-ylhepta-2,4,6-trien-2-yl] hypoiodite (PubChem CID 137490290) has the molecular formula C10H15IO and a molecular weight of 278.13 g/mol. Its IUPAC name is [(2E,4Z)-3-propan-2-ylhepta-2,4,6-trien-2-yl] hypoiodite.
| Compound Name | [(2E,4Z)-3-propan-2-ylhepta-2,4,6-trien-2-yl] hypoiodite |
|---|---|
| PubChem CID | 137490290 |
| Molecular Formula | C10H15IO |
| Molecular Weight | 278.13 g/mol |
| Exact Mass | 278.02 |
| IUPAC Name | [(2E,4Z)-3-propan-2-ylhepta-2,4,6-trien-2-yl] hypoiodite |
| SMILES | C=C/C=C\C(=C(/C)OI)C(C)C |
| InChI | InChI=1S/C10H15IO/c1-5-6-7-10(8(2)3)9(4)12-11/h5-8H,1H2,2-4H3/b7-6-,10-9- |
| InChIKey | OOANEQXWRHJJEG-HZJYTTRNSA-N |
| XLogP | 4.03 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.13 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|