C12H19NO2 — CID 142053613
(4Z,7Z)-2,6-dimethyl-10-nitrodeca-2,4,7-triene (PubChem CID 142053613) has the molecular formula C12H19NO2 and a molecular weight of 209.29 g/mol. Its IUPAC name is (4Z,7Z)-2,6-dimethyl-10-nitrodeca-2,4,7-triene.
| Compound Name | (4Z,7Z)-2,6-dimethyl-10-nitrodeca-2,4,7-triene |
|---|---|
| PubChem CID | 142053613 |
| Molecular Formula | C12H19NO2 |
| Molecular Weight | 209.29 g/mol |
| Exact Mass | 209.14 |
| IUPAC Name | (4Z,7Z)-2,6-dimethyl-10-nitrodeca-2,4,7-triene |
| SMILES | CC(C)=C/C=C\C(C)/C=C\CC[N+](=O)[O-] |
| InChI | InChI=1S/C12H19NO2/c1-11(2)7-6-9-12(3)8-4-5-10-13(14)15/h4,6-9,12H,5,10H2,1-3H3/b8-4-,9-6- |
| InChIKey | HVSKURMEHPFKED-WMGNBJRUSA-N |
| XLogP | 3.37 |
| TPSA | 43.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.29 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|