C11H19NO2 — CID 10535934
(6E)-2,6-dimethyl-9-nitronona-2,6-diene (PubChem CID 10535934) has the molecular formula C11H19NO2 and a molecular weight of 197.28 g/mol. Its IUPAC name is (6E)-2,6-dimethyl-9-nitronona-2,6-diene.
| Compound Name | (6E)-2,6-dimethyl-9-nitronona-2,6-diene |
|---|---|
| PubChem CID | 10535934 |
| Molecular Formula | C11H19NO2 |
| Molecular Weight | 197.28 g/mol |
| Exact Mass | 197.14 |
| IUPAC Name | (6E)-2,6-dimethyl-9-nitronona-2,6-diene |
| SMILES | CC(C)=CCC/C(C)=C/CC[N+](=O)[O-] |
| InChI | InChI=1S/C11H19NO2/c1-10(2)6-4-7-11(3)8-5-9-12(13)14/h6,8H,4-5,7,9H2,1-3H3/b11-8+ |
| InChIKey | JHESGIAMLSOIRK-DHZHZOJOSA-N |
| XLogP | 3.35 |
| TPSA | 43.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.28 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|