C17H29O4P — CID 140602252
methyl [(2E,5E,7E)-4,8,12-trimethyltrideca-2,5,7,11-tetraenyl] hydrogen phosphate (PubChem CID 140602252) has the molecular formula C17H29O4P and a molecular weight of 328.39 g/mol. Its IUPAC name is methyl [(2E,5E,7E)-4,8,12-trimethyltrideca-2,5,7,11-tetraenyl] hydrogen phosphate.
| Compound Name | methyl [(2E,5E,7E)-4,8,12-trimethyltrideca-2,5,7,11-tetraenyl] hydrogen phosphate |
|---|---|
| PubChem CID | 140602252 |
| Molecular Formula | C17H29O4P |
| Molecular Weight | 328.39 g/mol |
| Exact Mass | 328.18 |
| IUPAC Name | methyl [(2E,5E,7E)-4,8,12-trimethyltrideca-2,5,7,11-tetraenyl] hydrogen phosphate |
| SMILES | COP(=O)(O)OC/C=C/C(C)/C=C/C=C(\C)CCC=C(C)C |
| InChI | InChI=1S/C17H29O4P/c1-15(2)9-6-10-16(3)11-7-12-17(4)13-8-14-21-22(18,19)20-5/h7-9,11-13,17H,6,10,14H2,1-5H3,(H,18,19)/b12-7+,13-8+,16-11+ |
| InChIKey | YNZGZIAQFHJQAF-IHUSDUBKSA-N |
| XLogP | 5.19 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.39 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|