C11H19O4P — CID 140509369
[(1E,3E)-4,8-dimethylnona-1,3,7-trienyl] dihydrogen phosphate (PubChem CID 140509369) has the molecular formula C11H19O4P and a molecular weight of 246.24 g/mol. Its IUPAC name is [(1E,3E)-4,8-dimethylnona-1,3,7-trienyl] dihydrogen phosphate.
| Compound Name | [(1E,3E)-4,8-dimethylnona-1,3,7-trienyl] dihydrogen phosphate |
|---|---|
| PubChem CID | 140509369 |
| Molecular Formula | C11H19O4P |
| Molecular Weight | 246.24 g/mol |
| Exact Mass | 246.10 |
| IUPAC Name | [(1E,3E)-4,8-dimethylnona-1,3,7-trienyl] dihydrogen phosphate |
| SMILES | CC(C)=CCC/C(C)=C/C=C/OP(=O)(O)O |
| InChI | InChI=1S/C11H19O4P/c1-10(2)6-4-7-11(3)8-5-9-15-16(12,13)14/h5-6,8-9H,4,7H2,1-3H3,(H2,12,13,14)/b9-5+,11-8+ |
| InChIKey | WJKCIGIJHIJLSQ-NBBRJXQPSA-N |
| XLogP | 3.30 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.24 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|