C22H34O3P+ — CID 173398295
[(3E)-4,8-dimethylnona-1,3,7-trienoxy]-(4,8-dimethylnona-1,3,7-trienoxy)-oxophosphanium (PubChem CID 173398295) has the molecular formula C22H34O3P+ and a molecular weight of 377.49 g/mol. Its IUPAC name is [(3E)-4,8-dimethylnona-1,3,7-trienoxy]-(4,8-dimethylnona-1,3,7-trienoxy)-oxophosphanium.
| Compound Name | [(3E)-4,8-dimethylnona-1,3,7-trienoxy]-(4,8-dimethylnona-1,3,7-trienoxy)-oxophosphanium |
|---|---|
| PubChem CID | 173398295 |
| Molecular Formula | C22H34O3P+ |
| Molecular Weight | 377.49 g/mol |
| Exact Mass | 377.22 |
| IUPAC Name | [(3E)-4,8-dimethylnona-1,3,7-trienoxy]-(4,8-dimethylnona-1,3,7-trienoxy)-oxophosphanium |
| SMILES | CC(C)=CCCC(C)=CC=CO[P+](=O)OC=C/C=C(\C)CCC=C(C)C |
| InChI | InChI=1S/C22H34O3P/c1-19(2)11-7-13-21(5)15-9-17-24-26(23)25-18-10-16-22(6)14-8-12-20(3)4/h9-12,15-18H,7-8,13-14H2,1-6H3/q+1/b17-9?,18-10?,21-15+,22-16? |
| InChIKey | OJYGDZMFZQGKAM-MJAANTCHSA-N |
| XLogP | 8.09 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.49 |
| LogP ≤ 5 | 8.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|