C17H31P — CID 50905460
[(1E,3E)-4,8-dimethylnona-1,3,7-trienyl]-di(propan-2-yl)phosphane (PubChem CID 50905460) has the molecular formula C17H31P and a molecular weight of 266.41 g/mol. Its IUPAC name is [(1E,3E)-4,8-dimethylnona-1,3,7-trienyl]-di(propan-2-yl)phosphane.
| Compound Name | [(1E,3E)-4,8-dimethylnona-1,3,7-trienyl]-di(propan-2-yl)phosphane |
|---|---|
| PubChem CID | 50905460 |
| Molecular Formula | C17H31P |
| Molecular Weight | 266.41 g/mol |
| Exact Mass | 266.22 |
| IUPAC Name | [(1E,3E)-4,8-dimethylnona-1,3,7-trienyl]-di(propan-2-yl)phosphane |
| SMILES | CC(C)=CCC/C(C)=C/C=C/P(C(C)C)C(C)C |
| InChI | InChI=1S/C17H31P/c1-14(2)10-8-11-17(7)12-9-13-18(15(3)4)16(5)6/h9-10,12-13,15-16H,8,11H2,1-7H3/b13-9+,17-12+ |
| InChIKey | JQJZCNUXDJPIKA-PPIKXHHKSA-N |
| XLogP | 6.49 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.41 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|