C18H30F2O5P2 — CID 19854168
[difluoro-[methoxy-[(1E,3E,7E)-4,8,12-trimethyltrideca-1,3,7,11-tetraenyl]phosphoryl]methyl]phosphonic acid (PubChem CID 19854168) has the molecular formula C18H30F2O5P2 and a molecular weight of 426.38 g/mol. Its IUPAC name is [difluoro-[methoxy-[(1E,3E,7E)-4,8,12-trimethyltrideca-1,3,7,11-tetraenyl]phosphoryl]methyl]phosphonic acid.
| Compound Name | [difluoro-[methoxy-[(1E,3E,7E)-4,8,12-trimethyltrideca-1,3,7,11-tetraenyl]phosphoryl]methyl]phosphonic acid |
|---|---|
| PubChem CID | 19854168 |
| Molecular Formula | C18H30F2O5P2 |
| Molecular Weight | 426.38 g/mol |
| Exact Mass | 426.15 |
| IUPAC Name | [difluoro-[methoxy-[(1E,3E,7E)-4,8,12-trimethyltrideca-1,3,7,11-tetraenyl]phosphoryl]methyl]phosphonic acid |
| SMILES | COP(=O)(/C=C/C=C(\C)CC/C=C(\C)CCC=C(C)C)C(F)(F)P(=O)(O)O |
| InChI | InChI=1S/C18H30F2O5P2/c1-15(2)9-6-10-16(3)11-7-12-17(4)13-8-14-26(21,25-5)18(19,20)27(22,23)24/h8-9,11,13-14H,6-7,10,12H2,1-5H3,(H2,22,23,24)/b14-8+,16-11+,17-13+ |
| InChIKey | ZQMYXGYASMLYGO-WWESEOGYSA-N |
| XLogP | 6.57 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.38 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|