C17H27F2O5P2+ — CID 88633929
[difluoro(phosphono)methyl]-[(1E,3E,7E)-1-hydroxy-4,8,12-trimethyltrideca-1,3,7,11-tetraenyl]-oxophosphanium (PubChem CID 88633929) has the molecular formula C17H27F2O5P2+ and a molecular weight of 411.34 g/mol. Its IUPAC name is [difluoro(phosphono)methyl]-[(1E,3E,7E)-1-hydroxy-4,8,12-trimethyltrideca-1,3,7,11-tetraenyl]-oxophosphanium.
| Compound Name | [difluoro(phosphono)methyl]-[(1E,3E,7E)-1-hydroxy-4,8,12-trimethyltrideca-1,3,7,11-tetraenyl]-oxophosphanium |
|---|---|
| PubChem CID | 88633929 |
| Molecular Formula | C17H27F2O5P2+ |
| Molecular Weight | 411.34 g/mol |
| Exact Mass | 411.13 |
| IUPAC Name | [difluoro(phosphono)methyl]-[(1E,3E,7E)-1-hydroxy-4,8,12-trimethyltrideca-1,3,7,11-tetraenyl]-oxophosphanium |
| SMILES | CC(C)=CCC/C(C)=C/CC/C(C)=C/C=C(\O)[P+](=O)C(F)(F)P(=O)(O)O |
| InChI | InChI=1S/C17H26F2O5P2/c1-13(2)7-5-8-14(3)9-6-10-15(4)11-12-16(20)25(21)17(18,19)26(22,23)24/h7,9,11-12H,5-6,8,10H2,1-4H3,(H2-,20,22,23,24)/p+1/b14-9+,15-11+,16-12+ |
| InChIKey | FKAJIYJOGBWNMH-GDXIMDLHSA-O |
| XLogP | 6.36 |
| TPSA | 94.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.34 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|