C17H33NO5P2 — CID 54016219
[methoxy-(3,7,11-trimethyldodeca-2,6,10-trienylamino)phosphoryl]methylphosphonic acid (PubChem CID 54016219) has the molecular formula C17H33NO5P2 and a molecular weight of 393.40 g/mol. Its IUPAC name is [methoxy-(3,7,11-trimethyldodeca-2,6,10-trienylamino)phosphoryl]methylphosphonic acid.
| Compound Name | [methoxy-(3,7,11-trimethyldodeca-2,6,10-trienylamino)phosphoryl]methylphosphonic acid |
|---|---|
| PubChem CID | 54016219 |
| Molecular Formula | C17H33NO5P2 |
| Molecular Weight | 393.40 g/mol |
| Exact Mass | 393.18 |
| IUPAC Name | [methoxy-(3,7,11-trimethyldodeca-2,6,10-trienylamino)phosphoryl]methylphosphonic acid |
| SMILES | COP(=O)(CP(=O)(O)O)NCC=C(C)CCC=C(C)CCC=C(C)C |
| InChI | InChI=1S/C17H33NO5P2/c1-15(2)8-6-9-16(3)10-7-11-17(4)12-13-18-24(19,23-5)14-25(20,21)22/h8,10,12H,6-7,9,11,13-14H2,1-5H3,(H,18,19)(H2,20,21,22) |
| InChIKey | KVUROWATWAZVLQ-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 95.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.40 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|