C15H30O6P2 — CID 19108375
[[(5E)-6,10-dimethylundeca-5,9-dienoxy]methyl-hydroxyphosphoryl]methylphosphonic acid (PubChem CID 19108375) has the molecular formula C15H30O6P2 and a molecular weight of 368.35 g/mol. Its IUPAC name is [[(5E)-6,10-dimethylundeca-5,9-dienoxy]methyl-hydroxyphosphoryl]methylphosphonic acid.
| Compound Name | [[(5E)-6,10-dimethylundeca-5,9-dienoxy]methyl-hydroxyphosphoryl]methylphosphonic acid |
|---|---|
| PubChem CID | 19108375 |
| Molecular Formula | C15H30O6P2 |
| Molecular Weight | 368.35 g/mol |
| Exact Mass | 368.15 |
| IUPAC Name | [[(5E)-6,10-dimethylundeca-5,9-dienoxy]methyl-hydroxyphosphoryl]methylphosphonic acid |
| SMILES | CC(C)=CCC/C(C)=C/CCCCOCP(=O)(O)CP(=O)(O)O |
| InChI | InChI=1S/C15H30O6P2/c1-14(2)8-7-10-15(3)9-5-4-6-11-21-12-22(16,17)13-23(18,19)20/h8-9H,4-7,10-13H2,1-3H3,(H,16,17)(H2,18,19,20)/b15-9+ |
| InChIKey | ZYQUPSXJDYQFAI-OQLLNIDSSA-N |
| XLogP | 4.23 |
| TPSA | 104.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.35 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|