C16H30O6P2 — CID 19108361
[[(2E,6E)-7,11-dimethyldodeca-2,6,10-trienoxy]methyl-hydroxyphosphoryl]methylphosphonic acid (PubChem CID 19108361) has the molecular formula C16H30O6P2 and a molecular weight of 380.36 g/mol. Its IUPAC name is [[(2E,6E)-7,11-dimethyldodeca-2,6,10-trienoxy]methyl-hydroxyphosphoryl]methylphosphonic acid.
| Compound Name | [[(2E,6E)-7,11-dimethyldodeca-2,6,10-trienoxy]methyl-hydroxyphosphoryl]methylphosphonic acid |
|---|---|
| PubChem CID | 19108361 |
| Molecular Formula | C16H30O6P2 |
| Molecular Weight | 380.36 g/mol |
| Exact Mass | 380.15 |
| IUPAC Name | [[(2E,6E)-7,11-dimethyldodeca-2,6,10-trienoxy]methyl-hydroxyphosphoryl]methylphosphonic acid |
| SMILES | CC(C)=CCC/C(C)=C/CC/C=C/COCP(=O)(O)CP(=O)(O)O |
| InChI | InChI=1S/C16H30O6P2/c1-15(2)9-8-11-16(3)10-6-4-5-7-12-22-13-23(17,18)14-24(19,20)21/h5,7,9-10H,4,6,8,11-14H2,1-3H3,(H,17,18)(H2,19,20,21)/b7-5+,16-10+ |
| InChIKey | QJLNYEFJELKUET-AAELAGCISA-N |
| XLogP | 4.40 |
| TPSA | 104.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.36 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|