C19H38O6P2 — CID 54138303
[7,11-dimethyldodeca-6,10-dienoxymethyl(propan-2-yloxy)phosphoryl]methylphosphonic acid (PubChem CID 54138303) has the molecular formula C19H38O6P2 and a molecular weight of 424.46 g/mol. Its IUPAC name is [7,11-dimethyldodeca-6,10-dienoxymethyl(propan-2-yloxy)phosphoryl]methylphosphonic acid.
| Compound Name | [7,11-dimethyldodeca-6,10-dienoxymethyl(propan-2-yloxy)phosphoryl]methylphosphonic acid |
|---|---|
| PubChem CID | 54138303 |
| Molecular Formula | C19H38O6P2 |
| Molecular Weight | 424.46 g/mol |
| Exact Mass | 424.21 |
| IUPAC Name | [7,11-dimethyldodeca-6,10-dienoxymethyl(propan-2-yloxy)phosphoryl]methylphosphonic acid |
| SMILES | CC(C)=CCCC(C)=CCCCCCOCP(=O)(CP(=O)(O)O)OC(C)C |
| InChI | InChI=1S/C19H38O6P2/c1-17(2)11-10-13-19(5)12-8-6-7-9-14-24-15-26(20,25-18(3)4)16-27(21,22)23/h11-12,18H,6-10,13-16H2,1-5H3,(H2,21,22,23) |
| InChIKey | NZGXVPCBLWLHHR-UHFFFAOYSA-N |
| XLogP | 6.05 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.46 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|