C16H32O5P2 — CID 54550995
[1-[ethoxy(methyl)phosphoryl]-6,10-dimethylundeca-5,9-dienyl]phosphonic acid (PubChem CID 54550995) has the molecular formula C16H32O5P2 and a molecular weight of 366.38 g/mol. Its IUPAC name is [1-[ethoxy(methyl)phosphoryl]-6,10-dimethylundeca-5,9-dienyl]phosphonic acid.
| Compound Name | [1-[ethoxy(methyl)phosphoryl]-6,10-dimethylundeca-5,9-dienyl]phosphonic acid |
|---|---|
| PubChem CID | 54550995 |
| Molecular Formula | C16H32O5P2 |
| Molecular Weight | 366.38 g/mol |
| Exact Mass | 366.17 |
| IUPAC Name | [1-[ethoxy(methyl)phosphoryl]-6,10-dimethylundeca-5,9-dienyl]phosphonic acid |
| SMILES | CCOP(C)(=O)C(CCCC=C(C)CCC=C(C)C)P(=O)(O)O |
| InChI | InChI=1S/C16H32O5P2/c1-6-21-22(5,17)16(23(18,19)20)13-8-7-11-15(4)12-9-10-14(2)3/h10-11,16H,6-9,12-13H2,1-5H3,(H2,18,19,20) |
| InChIKey | ZJXBOCWLOLZGCM-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.38 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|